1-Pyrrolidineethanamine, N-(2-chloro-4-fluorophenyl)-
CAS No: 823189-86-2
Pyrrolidine
823189-86-2
pyrrolidineethanamine,chloro,fluorophenyl,pyrrolidine,823189-86-2
2025-10-20 Discover 1-Pyrrolidineethanamine, N-(2-chloro-4-fluorophenyl)- (CAS No: 823189-86-2) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.