1,1-Cyclopentanedicarboxylic acid,3-[(1E,4R)-4-hydroxy-4-phenyl-1-butenyl]-4-(1-methylethylidene)-,diethyl ester, (3R)-rel-
CAS No: 478176-06-6
Pentane
Order
88755-64-0
1,5-Pentanediamine, N-(6-chloro-8-quinolinyl)-N'-(1-methylethyl)-,monohydrochloride
478176-06-6
cyclopentanedicarboxylic,hydroxy,phenyl,butenyl,methylethylidene,diethyl,ester,pentane,478176-06-6
2025-10-21 Discover 1,1-Cyclopentanedicarboxylic acid,3-[(1E,4R)-4-hydroxy-4-phenyl-1-butenyl]-4-(1-methylethylidene)-,diethyl ester, (3R)-rel- (CAS No: 478176-06-6) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.